Compound Q&A

How is 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9) typically synthesized?

Answer

4,8-Disulfo-2,6-naphthalenedicarboxylic acid
4,8-Disulfo-2,6-naphthalenedicarboxylic acid can be synthesized via the condensation of naphthalene-2,6-dicarboxylic anhydride with sulfur dioxide. The reaction is conducted in the presence of a suitable catalyst to improve selectivity and yield. The process involves careful control of temperature and pressure to achieve the desired product.

About

English Name 4,8-Disulfo-2,6-naphthalenedicarboxylic acid
Molecular Formula C12H8O10S2
Molecular Weight 376.32 g/mol
SMILES O=C(C1=CC(S(=O)(O)=O)=C2C=C(C(O)=O)C=C(S(=O)(O)=O)C2=C1)O
InChIKey ZQWYRGRHXNAOLE-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid is a crystalline solid with a high molecular weight due...

Compound Q&A

What industries use 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

When handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...