Compound Q&A

What are the physical and chemical properties of 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

Answer

4,8-Disulfo-2,6-naphthalenedicarboxylic acid
4,8-Disulfo-2,6-naphthalenedicarboxylic acid is a crystalline solid with a high molecular weight due to its tetravalent structure. It has a solubility in water and organic solvents, which varies with temperature and polarity of the solvent. The compound is known for its reactivity, especially towards nucleophiles and electrophiles, and it can form complexes with various metals.

About

English Name 4,8-Disulfo-2,6-naphthalenedicarboxylic acid
Molecular Formula C12H8O10S2
Molecular Weight 376.32 g/mol
SMILES O=C(C1=CC(S(=O)(O)=O)=C2C=C(C(O)=O)C=C(S(=O)(O)=O)C2=C1)O
InChIKey ZQWYRGRHXNAOLE-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9) typically synthesized?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid can be synthesized via the condensation of naphthalene-...

Compound Q&A

What industries use 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

4,8-Disulfo-2,6-naphthalenedicarboxylic acid finds applications in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid (CAS: 742641-46-9)?

When handling 4,8-Disulfo-2,6-naphthalenedicarboxylic acid, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...