Compound Q&A

What industries use 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

Answer

4'-Pentyl-4-biphenylcarboxylic acid
4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is used in various industries, including pharmaceuticals for drug synthesis, polymers for material modification, and sensors for detecting specific chemical species. It is also used in the development of semiconductors and other advanced materials due to its unique chemical structure and reactivity.

About

CAS No 59662-47-4
English Name 4'-Pentyl-4-biphenylcarboxylic acid
Molecular Formula C18H20O2
Molecular Weight 268.36 g/mol
SMILES CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O
InChIKey VRGQQLFRUKMDSW-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is a white crystalline solid with a molecular ...

Compound Q&A

How is 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) typically synthesized?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is typically synthesized via a multistep proce...

Compound Q&A

What precautions should be taken when handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

When handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4), it is important to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...