Compound Q&A

How is 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) typically synthesized?

Answer

4'-Pentyl-4-biphenylcarboxylic acid
4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is typically synthesized via a multistep process involving the coupling of biphenyl and pentylation of the phenol group. Commonly, this involves using a Grignard reagent or another alkylation method. The reaction conditions, such as temperature and solvent, need to be carefully controlled to achieve high yield and selectivity. The final product is purified by recrystallization or other standard techniques.

About

CAS No 59662-47-4
English Name 4'-Pentyl-4-biphenylcarboxylic acid
Molecular Formula C18H20O2
Molecular Weight 268.36 g/mol
SMILES CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O
InChIKey VRGQQLFRUKMDSW-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is a white crystalline solid with a molecular ...

Compound Q&A

What industries use 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

When handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4), it is important to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...