Compound Q&A

What are the physical and chemical properties of 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

Answer

4'-Pentyl-4-biphenylcarboxylic acid
4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is a white crystalline solid with a molecular weight of approximately 290.39 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong bases. It has a melting point of around 85-87°C and a boiling point of about 353-356°C. It is used in various applications due to its unique structure and properties.

About

CAS No 59662-47-4
English Name 4'-Pentyl-4-biphenylcarboxylic acid
Molecular Formula C18H20O2
Molecular Weight 268.36 g/mol
SMILES CCCCCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)O
InChIKey VRGQQLFRUKMDSW-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) typically synthesized?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is typically synthesized via a multistep proce...

Compound Q&A

What industries use 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4)?

When handling 4'-Pentyl-4-biphenylcarboxylic acid (CAS: 59662-47-4), it is important to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...