Compound Q&A

How is Ampicillin EP Impurity E (CAS: 1207726-28-0) typically synthesized?

Answer

Ampicillin EP Impurity E
Ampicillin EP Impurity E (CAS: 1207726-28-0) is synthesized through the hydrolysis of ampicillin. This involves treating ampicillin with an aqueous base, such as sodium hydroxide, to produce the desired impurity. The reaction is selective and yields high purity of the impurity, which is then purified by techniques such as recrystallization or chromatography.

About

English Name Ampicillin EP Impurity E
Molecular Formula C24H26N4O5S
Molecular Weight 482.5620000000002 g/mol
SMILES CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)N)C(=O)N[C@H](c4ccccc4)C(=O)O)C
InChIKey VSAAMYOCWYQYDF-OSAVLUCMSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ampicillin EP Impurity E (CAS: 1207726-28-0)?

Ampicillin EP Impurity E (CAS: 1207726-28-0) is a white to off-white crystalline powder. It has a mo...

Compound Q&A

What industries use Ampicillin EP Impurity E (CAS: 1207726-28-0)?

Ampicillin EP Impurity E (CAS: 1207726-28-0) is primarily used in the pharmaceutical industry, parti...

Compound Q&A

What precautions should be taken when handling Ampicillin EP Impurity E (CAS: 1207726-28-0)?

When handling Ampicillin EP Impurity E (CAS: 1207726-28-0), it is important to use personal protecti...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...