Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

Answer

2,6-Dichloro-4-methoxybenzonitrile
Handling 2,6-Dichloro-4-methoxybenzonitrile requires appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coats. The compound should be stored in a cool, well-ventilated area away from sources of ignition. It should be handled in a fume hood to minimize exposure to its vapors. In case of a spill, contaminated clothing should be removed immediately, and the spill should be cleaned up using appropriate absorbent materials. Safety data sheets (SDS) should be consulted for detailed emergency response procedures and storage instructions.

About

CAS No 30482-87-2
English Name 2,6-Dichloro-4-methoxybenzonitrile
Molecular Formula C8H5Cl2NO
Molecular Weight 202.04 g/mol
SMILES COC1=CC(=C(C(=C1)Cl)C#N)Cl
InChIKey MTKOPGRUFMDVSS-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

2,6-Dichloro-4-methoxybenzonitrile is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2) typically synthesized?

2,6-Dichloro-4-methoxybenzonitrile is typically synthesized by the reaction of 4-methoxybenzonitrile...

Compound Q&A

What industries use 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

2,6-Dichloro-4-methoxybenzonitrile is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...