Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

Answer

2,6-Dichloro-4-methoxybenzonitrile
2,6-Dichloro-4-methoxybenzonitrile is a crystalline solid with a molecular weight of approximately 232.04 g/mol. It has a low solubility in water (0.03 g/100 mL at 20°C) and is soluble in common organic solvents such as ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles and metal complexes, making it suitable for various chemical transformations. It is stable under normal conditions but should be handled with care due to its reactivity.

About

CAS No 30482-87-2
English Name 2,6-Dichloro-4-methoxybenzonitrile
Molecular Formula C8H5Cl2NO
Molecular Weight 202.04 g/mol
SMILES COC1=CC(=C(C(=C1)Cl)C#N)Cl
InChIKey MTKOPGRUFMDVSS-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2) typically synthesized?

2,6-Dichloro-4-methoxybenzonitrile is typically synthesized by the reaction of 4-methoxybenzonitrile...

Compound Q&A

What industries use 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

2,6-Dichloro-4-methoxybenzonitrile is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

Handling 2,6-Dichloro-4-methoxybenzonitrile requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...