Compound Q&A

How is 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2) typically synthesized?

Answer

2,6-Dichloro-4-methoxybenzonitrile
2,6-Dichloro-4-methoxybenzonitrile is typically synthesized by the reaction of 4-methoxybenzonitrile with chlorine gas in the presence of a Lewis acid catalyst, such as aluminum chloride (AlCl3). The reaction is carried out under anhydrous conditions to ensure optimal yield and selectivity. The process involves the substitution of two chlorine atoms on the benzene ring, leading to the formation of the desired product with high selectivity and good yield.

About

CAS No 30482-87-2
English Name 2,6-Dichloro-4-methoxybenzonitrile
Molecular Formula C8H5Cl2NO
Molecular Weight 202.04 g/mol
SMILES COC1=CC(=C(C(=C1)Cl)C#N)Cl
InChIKey MTKOPGRUFMDVSS-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

2,6-Dichloro-4-methoxybenzonitrile is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

2,6-Dichloro-4-methoxybenzonitrile is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-4-methoxybenzonitrile (CAS: 30482-87-2)?

Handling 2,6-Dichloro-4-methoxybenzonitrile requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...