Compound Q&A

What precautions should be taken when handling 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

Answer

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
Proper protective equipment (PPE) such as gloves, goggles, and lab coats should be worn when handling 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene. Work should be conducted in a fume hood to minimize inhalation risk. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
Molecular Formula C29H18Br2
Molecular Weight 526.26 g/mol
SMILES C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C5=CC=CC=C54)Br)C6=CC=CC=C6
InChIKey DQOKACQQFORURI-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

How is 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2) typically synthesized?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is typically synthesized through bromination of 7,7-dip...

Compound Q&A

What industries use 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...