Compound Q&A

How is 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2) typically synthesized?

Answer

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is typically synthesized through bromination of 7,7-diphenyl-7H-benzo[c]fluorene using N-bromosuccinimide (NBS) in the presence of a radical initiator. This method provides good selectivity and yield, with the product isolated by recrystallization.

About

English Name 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
Molecular Formula C29H18Br2
Molecular Weight 526.26 g/mol
SMILES C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C5=CC=CC=C54)Br)C6=CC=CC=C6
InChIKey DQOKACQQFORURI-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

What industries use 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

Proper protective equipment (PPE) such as gloves, goggles, and lab coats should be worn when handlin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...