Compound Q&A

What industries use 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

Answer

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is used in the pharmaceutical industry for the synthesis of certain drugs, in semiconductor manufacturing for creating functional materials, and in polymer science for developing advanced materials with unique optical and electronic properties.

About

English Name 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene
Molecular Formula C29H18Br2
Molecular Weight 526.26 g/mol
SMILES C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C5=CC=CC=C54)Br)C6=CC=CC=C6
InChIKey DQOKACQQFORURI-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is a solid with a crystalline form. Its molecular weigh...

Compound Q&A

How is 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2) typically synthesized?

5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene is typically synthesized through bromination of 7,7-dip...

Compound Q&A

What precautions should be taken when handling 5,9-dibromo-7,7-diphenyl-7H-Benzo[c]fluorene (CAS: 854952-90-2)?

Proper protective equipment (PPE) such as gloves, goggles, and lab coats should be worn when handlin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...