Compound Q&A

What industries use 4-Phenylthieno[3,2-c]pyridine (CAS: 81820-65-7)?

Answer

4-Phenylthieno[3,2-c]pyridine
4-Phenylthieno[3,2-c]pyridine is used in the pharmaceutical industry for its potential in developing new drug candidates, particularly in the field of anticancer agents and as a scaffold for medicinal chemistry. It is also utilized in the semiconductor industry due to its electronic properties and in the polymer industry for its potential as a monomer or additive. Additionally, it plays a role in sensors due to its ability to interact with certain molecules and ions.

About

CAS No 81820-65-7
English Name 4-Phenylthieno[3,2-c]pyridine
Molecular Formula C13H9NS
Molecular Weight 211.29 g/mol
SMILES C1=CC=C(C=C1)C2=NC=CC3=C2C=CS3
InChIKey UEXKIEYHNLJFQH-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Phenylthieno[3,2-c]pyridine (CAS: 81820-65-7)?

4-Phenylthieno[3,2-c]pyridine is a crystalline solid with a molecular weight of approximately 228.25...

Compound Q&A

How is 4-Phenylthieno[3,2-c]pyridine (CAS: 81820-65-7) typically synthesized?

4-Phenylthieno[3,2-c]pyridine is often synthesized through a multi-step process involving the reacti...

Compound Q&A

What precautions should be taken when handling 4-Phenylthieno[3,2-c]pyridine (CAS: 81820-65-7)?

When handling 4-Phenylthieno[3,2-c]pyridine, it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...