Compound Q&A

What industries use (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

Answer

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry as a monomer for special polymers. Additionally, it finds applications in the production of chemical sensors and as an intermediate in the development of semiconductor materials.

About

CAS No 15329-69-8
English Name (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES C1=CC=C(C=C1)CNC(=O)C=CC(=O)O
InChIKey BHWGQIYJCMMSNM-SREVYHEPSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is a crystalline solid with a molecular...

Compound Q&A

How is (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) typically synthesized?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid is usually synthesized via the condensation of benzylamin...

Compound Q&A

What precautions should be taken when handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

When handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8), it is crucial to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...