Compound Q&A

What are the physical and chemical properties of (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

Answer

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is a crystalline solid with a molecular weight of approximately 224.27 g/mol. It has good solubility in organic solvents like methanol and acetone but is only slightly soluble in water. This compound shows high reactivity towards nucleophiles and can undergo various chemical reactions such as esterification and amidation. It is also prone to hydrolysis under acidic or basic conditions.

About

CAS No 15329-69-8
English Name (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES C1=CC=C(C=C1)CNC(=O)C=CC(=O)O
InChIKey BHWGQIYJCMMSNM-SREVYHEPSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

How is (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) typically synthesized?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid is usually synthesized via the condensation of benzylamin...

Compound Q&A

What industries use (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

When handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8), it is crucial to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...