Compound Q&A

How is (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) typically synthesized?

Answer

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid is usually synthesized via the condensation of benzylamine with acryloyl chloride in the presence of a base like triethylamine. The reaction gives good yield and selectivity, with the final product being isolated by recrystallization from appropriate solvents. This method ensures the formation of the correct isomer through the use of a suitable protecting group and selective conditions.

About

CAS No 15329-69-8
English Name (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES C1=CC=C(C=C1)CNC(=O)C=CC(=O)O
InChIKey BHWGQIYJCMMSNM-SREVYHEPSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is a crystalline solid with a molecular...

Compound Q&A

What industries use (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

(2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8)?

When handling (2Z)-4-(Benzylamino)-4-oxo-2-butenoic acid (CAS: 15329-69-8), it is crucial to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...