Compound Q&A

How is N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide (CAS: 639090-55-4) typically synthesized?

Answer

N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide
N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide is typically synthesized through amidation of a sulfide derivative of 4-chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidine and cyclopropanecarboxylic acid chloride. The reaction is catalyzed by a Lewis acid, resulting in a high yield of the target compound. The process involves careful control of temperature and reaction time to ensure high selectivity and yield.

About

English Name N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide
Molecular Formula C18H17ClN6OS
Molecular Weight 400.9 g/mol
SMILES CC1=CC(=NN1)NC2=CC(=NC(=N2)SC3=CC=C(C=C3)NC(=O)C4CC4)Cl
InChIKey ULVNROIYQBQKBP-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide (CAS: 639090-55-4)?

This compound is a crystalline solid with a molecular weight of approximately 509.2 g/mol. It has li...

Compound Q&A

What industries use N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide (CAS: 639090-55-4)?

This compound is primarily used in the pharmaceutical industry for its potential as an antiviral and...

Compound Q&A

What precautions should be taken when handling N-[4-({4-Chloro-6-[(5-methyl-1H-pyrazol-3-yl)amino]-2-pyrimidinyl}sulfanyl)phenyl]cyclopropanecarboxamide (CAS: 639090-55-4)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...