Compound Q&A

What are the physical and chemical properties of Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (CAS: 103877-51-6)?

Answer

Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate
Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate is a crystalline compound with a molecular weight of approximately 324.7 g/mol. It is slightly soluble in water but soluble in organic solvents like methanol and ethanol. The compound exhibits good stability under normal temperature and pressure conditions. However, it can undergo hydrolysis in the presence of moisture and acidic or basic conditions.

About

English Name Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate
Molecular Formula C16H16ClNO3
Molecular Weight 305.76 g/mol
SMILES CCOC(=O)C1=CN(C2=C(C1=O)C=CC(=C2C)Cl)C3CC3
InChIKey MUQYAFBHOLSOCY-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (CAS: 103877-51-6) typically synthesized?

Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate is synthesized via a multistep pr...

Compound Q&A

What industries use Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (CAS: 103877-51-6)?

Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate is primarily used in the pharmace...

Compound Q&A

What precautions should be taken when handling Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate (CAS: 103877-51-6)?

When handling Ethyl 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylate, it is crucial to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...