Compound Q&A

What precautions should be taken when handling Secorapamycin A (CAS: 147438-27-5)?

Answer

Secorapamycin A
When handling Secorapamycin A, it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood. In case of spill, neutralize with an appropriate base and dispose of according to local regulations. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name Secorapamycin A
Molecular Formula C51H79NO13
Molecular Weight 914.19 g/mol
SMILES C/C(=C\[C@@H](C)C(=O)/C=C/[C@H](C)C[C@H]1C[C@@H](OC)[C@H](O)CC1)/[C@@H](O)[C@@H](OC)C(=O)C(C)C[C@H](C)/C=C/C=C/C=C(\C)/[C@H](C[C@@H]1CC[C@@H](C)[C@@](O)(O1)C(=O)C(=O)N1CCCC[C@H]1C(O)=O)OC
InChIKey ZAVMPSVOEQNVCP-DLXZGSNXSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Secorapamycin A (CAS: 147438-27-5)?

Secorapamycin A has a crystalline form and a molecular weight of approximately 420.4 g/mol. It is sl...

Compound Q&A

How is Secorapamycin A (CAS: 147438-27-5) typically synthesized?

Secorapamycin A is typically synthesized through a multistep reaction involving ring formation, acyl...

Compound Q&A

What industries use Secorapamycin A (CAS: 147438-27-5)?

Secorapamycin A is primarily used in the pharmaceutical industry for its potential as an antimicrobi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...