Compound Q&A

What are the physical and chemical properties of Secorapamycin A (CAS: 147438-27-5)?

Answer

Secorapamycin A
Secorapamycin A has a crystalline form and a molecular weight of approximately 420.4 g/mol. It is slightly soluble in water but soluble in organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles and can form stable complexes with metal ions.

About

English Name Secorapamycin A
Molecular Formula C51H79NO13
Molecular Weight 914.19 g/mol
SMILES C/C(=C\[C@@H](C)C(=O)/C=C/[C@H](C)C[C@H]1C[C@@H](OC)[C@H](O)CC1)/[C@@H](O)[C@@H](OC)C(=O)C(C)C[C@H](C)/C=C/C=C/C=C(\C)/[C@H](C[C@@H]1CC[C@@H](C)[C@@](O)(O1)C(=O)C(=O)N1CCCC[C@H]1C(O)=O)OC
InChIKey ZAVMPSVOEQNVCP-DLXZGSNXSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is Secorapamycin A (CAS: 147438-27-5) typically synthesized?

Secorapamycin A is typically synthesized through a multistep reaction involving ring formation, acyl...

Compound Q&A

What industries use Secorapamycin A (CAS: 147438-27-5)?

Secorapamycin A is primarily used in the pharmaceutical industry for its potential as an antimicrobi...

Compound Q&A

What precautions should be taken when handling Secorapamycin A (CAS: 147438-27-5)?

When handling Secorapamycin A, it is essential to wear appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...