Compound Q&A

How is Secorapamycin A (CAS: 147438-27-5) typically synthesized?

Answer

Secorapamycin A
Secorapamycin A is typically synthesized through a multistep reaction involving ring formation, acylation, and alkylation. Commonly used catalysts include phosphoryl chloride and triethylamine. The overall yield is moderate, around 50-60%, with high regioselectivity and stereoselectivity.

About

English Name Secorapamycin A
Molecular Formula C51H79NO13
Molecular Weight 914.19 g/mol
SMILES C/C(=C\[C@@H](C)C(=O)/C=C/[C@H](C)C[C@H]1C[C@@H](OC)[C@H](O)CC1)/[C@@H](O)[C@@H](OC)C(=O)C(C)C[C@H](C)/C=C/C=C/C=C(\C)/[C@H](C[C@@H]1CC[C@@H](C)[C@@](O)(O1)C(=O)C(=O)N1CCCC[C@H]1C(O)=O)OC
InChIKey ZAVMPSVOEQNVCP-DLXZGSNXSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Secorapamycin A (CAS: 147438-27-5)?

Secorapamycin A has a crystalline form and a molecular weight of approximately 420.4 g/mol. It is sl...

Compound Q&A

What industries use Secorapamycin A (CAS: 147438-27-5)?

Secorapamycin A is primarily used in the pharmaceutical industry for its potential as an antimicrobi...

Compound Q&A

What precautions should be taken when handling Secorapamycin A (CAS: 147438-27-5)?

When handling Secorapamycin A, it is essential to wear appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...