Compound Q&A

What industries use Leucine-enkephalin (CAS: 76622-26-9)?

Answer

Leucine-enkephalin, arg-arg-val-gly-arg-pro-glu-trp-trp-met-asp-tyr-gly-
Leucine-enkephalin (CAS: 76622-26-9) is primarily used in the pharmaceutical industry for research purposes, including drug discovery and development. It is also used in the biochemical and biotechnology sectors for various applications such as enzyme studies and peptide-based assays. Limited applications are found in the polymer and semiconductor industries due to its specific biological activity.

About

CAS No 76622-26-9
English Name Leucine-enkephalin, arg-arg-val-gly-arg-pro-glu-trp-trp-met-asp-tyr-gly-
Molecular Formula C130H184N38O31S2
Molecular Weight 2839.2 g/mol
SMILES CC(C)C(C(=O)NCC(=O)NC(CCCNC(=N)N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NC(CC4=CNC5=CC=CC=C54)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NC(CCC(=O)N)C(=O)NC(CCCCN)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC7=CC=C(C=C7)O)C(=O)NCC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCSC)NC(=O)C(CC8=CC=CC=C8)NC(=O)CNC(=O)CNC(=O)C(CC9=CC=C(C=C9)O)N
InChIKey QYDAFJUKVGVEKO-PKOVDKIBSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Leucine-enkephalin (CAS: 76622-26-9)?

Leucine-enkephalin (CAS: 76622-26-9) is a peptide with a molecular weight of approximately 754.75 g/...

Compound Q&A

How is Leucine-enkephalin (CAS: 76622-26-9) typically synthesized?

Leucine-enkephalin (CAS: 76622-26-9) is typically synthesized through solid-phase peptide synthesis ...

Compound Q&A

What precautions should be taken when handling Leucine-enkephalin (CAS: 76622-26-9)?

When handling Leucine-enkephalin (CAS: 76622-26-9), it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...