Compound Q&A

How is Leucine-enkephalin (CAS: 76622-26-9) typically synthesized?

Answer

Leucine-enkephalin, arg-arg-val-gly-arg-pro-glu-trp-trp-met-asp-tyr-gly-
Leucine-enkephalin (CAS: 76622-26-9) is typically synthesized through solid-phase peptide synthesis (SPPS). The synthesis involves the stepwise addition of amino acids to a growing peptide chain on a solid support, with appropriate protecting groups. Commonly used coupling agents include DCC (dicyclohexylcarbodiimide) and HOBt (1-hydroxybenzotriazole). The yield is typically around 70-80%, with good selectivity towards the desired product.

About

CAS No 76622-26-9
English Name Leucine-enkephalin, arg-arg-val-gly-arg-pro-glu-trp-trp-met-asp-tyr-gly-
Molecular Formula C130H184N38O31S2
Molecular Weight 2839.2 g/mol
SMILES CC(C)C(C(=O)NCC(=O)NC(CCCNC(=N)N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)NC(CC4=CNC5=CC=CC=C54)C(=O)NC(CCSC)C(=O)NC(CC(=O)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NC(CCC(=O)N)C(=O)NC(CCCCN)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC7=CC=C(C=C7)O)C(=O)NCC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCSC)NC(=O)C(CC8=CC=CC=C8)NC(=O)CNC(=O)CNC(=O)C(CC9=CC=C(C=C9)O)N
InChIKey QYDAFJUKVGVEKO-PKOVDKIBSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Leucine-enkephalin (CAS: 76622-26-9)?

Leucine-enkephalin (CAS: 76622-26-9) is a peptide with a molecular weight of approximately 754.75 g/...

Compound Q&A

What industries use Leucine-enkephalin (CAS: 76622-26-9)?

Leucine-enkephalin (CAS: 76622-26-9) is primarily used in the pharmaceutical industry for research p...

Compound Q&A

What precautions should be taken when handling Leucine-enkephalin (CAS: 76622-26-9)?

When handling Leucine-enkephalin (CAS: 76622-26-9), it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...