Compound Q&A

How is 4,7-dichloroquinoline-3-carboxylic Acid (CAS: 630067-21-9) typically synthesized?

Answer

4,7-dichloroquinoline-3-carboxylic Acid
4,7-Dichloroquinoline-3-carboxylic Acid is typically synthesized through the condensation of 4,7-dichloroquinoline with acetic anhydride in the presence of a catalyst like potassium carbonate. The reaction is performed in an inert atmosphere to prevent oxidation and achieve high selectivity and yield.

About

English Name 4,7-dichloroquinoline-3-carboxylic Acid
Molecular Formula C10H5Cl2NO2
Molecular Weight 242.06 g/mol
SMILES C1=CC2=C(C(=CN=C2C=C1Cl)C(=O)O)Cl
InChIKey MLBIOMJMHCNLEL-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,7-dichloroquinoline-3-carboxylic Acid (CAS: 630067-21-9)?

4,7-Dichloroquinoline-3-carboxylic Acid is a crystalline solid with a molecular weight of approximat...

Compound Q&A

What industries use 4,7-dichloroquinoline-3-carboxylic Acid (CAS: 630067-21-9)?

4,7-Dichloroquinoline-3-carboxylic Acid is used in various industries. It is a key intermediate in t...

Compound Q&A

What precautions should be taken when handling 4,7-dichloroquinoline-3-carboxylic Acid (CAS: 630067-21-9)?

When handling 4,7-dichloroquinoline-3-carboxylic Acid, safety goggles and gloves should be worn to p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...