Compound Q&A

What industries use 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

Answer

5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
This compound is used in the pharmaceutical industry for its potential as an antimicrobial agent. It is also explored in sensor technology for its ability to detect specific analytes and in polymer science for its use in developing novel materials with specific properties.

About

English Name 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
Molecular Formula C16H22ClN3O3
Molecular Weight 339.82 g/mol
SMILES CN1C2=C(C=C(C=C2)N(CCO)CCCl)N=C1CCCC(=O)O
InChIKey PFTRYOMJJKBZKV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

The compound has a crystalline form with a molecular weight of approximately 437.86 g/mol. It has lo...

Compound Q&A

How is 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1) typically synthesized?

The compound is synthesized via a multi-step process starting with benzimidazole, followed by the in...

Compound Q&A

What precautions should be taken when handling 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

Proper personal protective equipment (PPE) is required, including gloves, goggles, and a lab coat. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...