Compound Q&A

How is 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1) typically synthesized?

Answer

5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
The compound is synthesized via a multi-step process starting with benzimidazole, followed by the introduction of the 5-amino group, and then the introduction of the 2-(2-chloroethyl) and 2-(2-hydroxyethyl) groups. Common reagents include chloroethyl bromide and 2-hydroxyethylamine, with the use of appropriate bases and solvents to ensure selectivity and high yield.

About

English Name 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
Molecular Formula C16H22ClN3O3
Molecular Weight 339.82 g/mol
SMILES CN1C2=C(C=C(C=C2)N(CCO)CCCl)N=C1CCCC(=O)O
InChIKey PFTRYOMJJKBZKV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

The compound has a crystalline form with a molecular weight of approximately 437.86 g/mol. It has lo...

Compound Q&A

What industries use 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

This compound is used in the pharmaceutical industry for its potential as an antimicrobial agent. It...

Compound Q&A

What precautions should be taken when handling 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

Proper personal protective equipment (PPE) is required, including gloves, goggles, and a lab coat. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...