Compound Q&A

What are the physical and chemical properties of 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

Answer

5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
The compound has a crystalline form with a molecular weight of approximately 437.86 g/mol. It has low solubility in water and moderate solubility in organic solvents. Chemically, it is stable under normal conditions but reacts with strong bases to form corresponding salts. It is slightly basic in nature and can undergo substitution reactions.

About

English Name 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid
Molecular Formula C16H22ClN3O3
Molecular Weight 339.82 g/mol
SMILES CN1C2=C(C=C(C=C2)N(CCO)CCCl)N=C1CCCC(=O)O
InChIKey PFTRYOMJJKBZKV-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1) typically synthesized?

The compound is synthesized via a multi-step process starting with benzimidazole, followed by the in...

Compound Q&A

What industries use 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

This compound is used in the pharmaceutical industry for its potential as an antimicrobial agent. It...

Compound Q&A

What precautions should be taken when handling 5-[(2-Chloroethyl)(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid (CAS: 109882-27-1)?

Proper personal protective equipment (PPE) is required, including gloves, goggles, and a lab coat. W...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...