Compound Q&A

What industries use (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5)?

Answer

(2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
This compound is primarily used in the pharmaceutical industry for its potential as a bioactive molecule. It may also find applications in the chemical industry for its reactivity and functional groups, making it useful in the development of new materials and sensors. Further research is ongoing to explore its use in semiconductors and other advanced technologies.

About

CAS No 41744-40-5
English Name (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Molecular Formula C16H18N2O7S2
Molecular Weight 414.46 g/mol
SMILES CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)S(=O)(=O)O)C(=O)O)C
InChIKey JETQIUPBHQNHNZ-NJBDSQKTSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5) typically synthesized?

The compound is synthesized through a multi-step process involving amidation and sulfonation reactio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...