Compound Q&A

What are the physical and chemical properties of (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5)?

Answer

(2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
This compound is a white crystalline solid with a molecular weight of approximately 426.34 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits high reactivity towards nucleophiles and can undergo condensation reactions. The compound is stable under normal conditions but requires protection from moisture and air. It has a melting point of 190-192°C and a pKa of 3.8.

About

CAS No 41744-40-5
English Name (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Molecular Formula C16H18N2O7S2
Molecular Weight 414.46 g/mol
SMILES CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)S(=O)(=O)O)C(=O)O)C
InChIKey JETQIUPBHQNHNZ-NJBDSQKTSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5) typically synthesized?

The compound is synthesized through a multi-step process involving amidation and sulfonation reactio...

Compound Q&A

What industries use (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...