Compound Q&A

How is (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5) typically synthesized?

Answer

(2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
The compound is synthesized through a multi-step process involving amidation and sulfonation reactions. Key steps include the preparation of the sulfoacetyl derivative of the phenyl group, followed by amidation with the azabicyclic amine. The reaction is typically conducted in the presence of an acid catalyst and requires precise control of temperature and reaction time to achieve high yield and selectivity.

About

CAS No 41744-40-5
English Name (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Molecular Formula C16H18N2O7S2
Molecular Weight 414.46 g/mol
SMILES CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)S(=O)(=O)O)C(=O)O)C
InChIKey JETQIUPBHQNHNZ-NJBDSQKTSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What industries use (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-{[(2R)-2-phenyl-2-sulfoacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 41744-40-5)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...