Compound Q&A

What industries use (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

Answer

(2-Fluorophenyl)(oxo)acetic acid
(2-Fluorophenyl)(oxo)acetic acid finds applications in the pharmaceutical and chemical industries. It serves as a precursor in the synthesis of various fluorinated compounds and can be used in the development of new drugs. Additionally, it may be used in the production of certain polymers and in the preparation of sensors and semiconductors.

About

CAS No 79477-86-4
English Name (2-Fluorophenyl)(oxo)acetic acid
Molecular Formula C8H5FO3
Molecular Weight 168.12 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(=O)O)F
InChIKey NNBNIEJYCZQNEK-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

(2-Fluorophenyl)(oxo)acetic acid is a white crystalline solid with a molecular weight of approximate...

Compound Q&A

How is (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4) typically synthesized?

(2-Fluorophenyl)(oxo)acetic acid can be synthesized by the acetylation of 2-fluorophenol. The reacti...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

When handling (2-Fluorophenyl)(oxo)acetic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...