Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

Answer

(2-Fluorophenyl)(oxo)acetic acid
(2-Fluorophenyl)(oxo)acetic acid is a white crystalline solid with a molecular weight of approximately 191.07 g/mol. It has a melting point of around 162-164°C and is slightly soluble in water. The compound is reactive, particularly towards nucleophiles due to the presence of the acetoxy group and the fluoro substituent.

About

CAS No 79477-86-4
English Name (2-Fluorophenyl)(oxo)acetic acid
Molecular Formula C8H5FO3
Molecular Weight 168.12 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(=O)O)F
InChIKey NNBNIEJYCZQNEK-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4) typically synthesized?

(2-Fluorophenyl)(oxo)acetic acid can be synthesized by the acetylation of 2-fluorophenol. The reacti...

Compound Q&A

What industries use (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

(2-Fluorophenyl)(oxo)acetic acid finds applications in the pharmaceutical and chemical industries. I...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

When handling (2-Fluorophenyl)(oxo)acetic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...