Compound Q&A

How is (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4) typically synthesized?

Answer

(2-Fluorophenyl)(oxo)acetic acid
(2-Fluorophenyl)(oxo)acetic acid can be synthesized by the acetylation of 2-fluorophenol. The reaction involves treating 2-fluorophenol with acetic anhydride in the presence of an acid catalyst, such as sulfuric acid, at elevated temperatures. The product mixture is then purified through recrystallization or distillation.

About

CAS No 79477-86-4
English Name (2-Fluorophenyl)(oxo)acetic acid
Molecular Formula C8H5FO3
Molecular Weight 168.12 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(=O)O)F
InChIKey NNBNIEJYCZQNEK-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

(2-Fluorophenyl)(oxo)acetic acid is a white crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

(2-Fluorophenyl)(oxo)acetic acid finds applications in the pharmaceutical and chemical industries. I...

Compound Q&A

What precautions should be taken when handling (2-Fluorophenyl)(oxo)acetic acid (CAS: 79477-86-4)?

When handling (2-Fluorophenyl)(oxo)acetic acid, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...