Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

Answer

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is utilized in the pharmaceutical industry for its reactivity and functional groups, aiding in the synthesis of drug intermediates. It is also employed in the polymer industry as a monomer or additive due to its unique chemical properties. Additionally, it has applications in the production of sensors and semiconductors, where its high reactivity makes it suitable for specific chemical reactions.

About

English Name 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3Cl2F3O2S
Molecular Weight 279.07 g/mol
SMILES FC(F)(F)c1cc(Cl)cc(c1)S(=O)(=O)Cl
InChIKey JYUGVORTFRFETG-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is a crystalline solid with a high melting poin...

Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4) typically synthesized?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is typically synthesized via the sulfonation of...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

When handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...