Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4) typically synthesized?

Answer

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is typically synthesized via the sulfonation of 3-chloro-5-(trifluoromethyl)benzene using concentrated sulfuric acid. The reaction is conducted in a fume hood to manage the volatile gases produced. The product is then chlorosulfonated, often using thionyl chloride, to generate the sulfonate chloride. The process requires careful control of temperature and concentration to achieve high yield and selectivity.

About

English Name 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3Cl2F3O2S
Molecular Weight 279.07 g/mol
SMILES FC(F)(F)c1cc(Cl)cc(c1)S(=O)(=O)Cl
InChIKey JYUGVORTFRFETG-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is a crystalline solid with a high melting poin...

Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is utilized in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

When handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...