Compound Q&A

What are the physical and chemical properties of 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

Answer

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is a crystalline solid with a high melting point. Its molecular weight is approximately 335.01 g/mol. This compound has low water solubility but is soluble in polar organic solvents like DMSO and DMF. It is known for its high reactivity, particularly in nucleophilic substitution and electrophilic aromatic substitution reactions.

About

English Name 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3Cl2F3O2S
Molecular Weight 279.07 g/mol
SMILES FC(F)(F)c1cc(Cl)cc(c1)S(=O)(=O)Cl
InChIKey JYUGVORTFRFETG-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4) typically synthesized?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is typically synthesized via the sulfonation of...

Compound Q&A

What industries use 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride is utilized in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride (CAS: 875167-01-4)?

When handling 3-Chloro-5-(trifluoromethyl)benzenesulfonyl chloride, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...