Compound Q&A

What industries use (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (CAS: 1916569-82-8)?

Answer

(2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (1:1)
(2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride finds applications in various industries, particularly in pharmaceuticals where it can be used as a precursor for drug synthesis. It is also utilized in the production of certain dyes and pigments, and as a reagent in analytical chemistry for developing colorimetric sensors due to its chromogenic properties.

About

English Name (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (1:1)
Molecular Formula C8H11BrClNO
Molecular Weight 252.54 g/mol
SMILES c1cc(ccc1[C@H](CO)N)Br.Cl
InChIKey PQQGURGSEYFRCS-QRPNPIFTSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (CAS: 1916569-82-8)?

(2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride is a white crystalline solid with a molecular we...

Compound Q&A

How is (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (CAS: 1916569-82-8) typically synthesized?

(2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride can be synthesized by several methods, including...

Compound Q&A

What precautions should be taken when handling (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride (CAS: 1916569-82-8)?

When handling (2R)-2-Amino-2-(4-bromophenyl)ethanol hydrochloride, it is important to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...