Compound Q&A

What industries use 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

Answer

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene
3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various medicinal compounds. It also finds applications in the semiconductor industry for doping purposes and in the development of chemical sensors.

About

English Name 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene
Molecular Formula C12H13BrS
Molecular Weight 269.21 g/mol
SMILES CC(C)(C)c1ccc2c(c1)c(cs2)Br
InChIKey TUVDJRXZHABERX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is a white to pale yellow crystalline solid with a ...

Compound Q&A

How is 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6) typically synthesized?

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is typically synthesized via a bromination reaction...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

When handling 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene, it is crucial to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...