Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

Answer

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene
3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is a white to pale yellow crystalline solid with a molecular weight of approximately 285.17 g/mol. It is slightly soluble in common organic solvents like dichloromethane and acetone. It is highly reactive towards nucleophiles, particularly bromine, and exhibits characteristic thiophene ring reactivity.

About

English Name 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene
Molecular Formula C12H13BrS
Molecular Weight 269.21 g/mol
SMILES CC(C)(C)c1ccc2c(c1)c(cs2)Br
InChIKey TUVDJRXZHABERX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6) typically synthesized?

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is typically synthesized via a bromination reaction...

Compound Q&A

What industries use 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene (CAS: 1780644-81-6)?

When handling 3-Bromo-5-(2-methyl-2-propanyl)-1-benzothiophene, it is crucial to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...