Compound Q&A

How is (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5) typically synthesized?

Answer

(5-Methyl-1-benzothiophen-2-yl)boronic acid
(5-Methyl-1-benzothiophen-2-yl)boronic acid is typically synthesized via a Suzuki coupling reaction, where a boronic acid reacts with a bromo or iodo benzothiophene derivative in the presence of a palladium catalyst and a base. This method provides high selectivity and yield, making it a common approach in synthetic chemistry.

About

English Name (5-Methyl-1-benzothiophen-2-yl)boronic acid
Molecular Formula C9H9BO2S
Molecular Weight 192.05 g/mol
SMILES B(C1=CC2=C(S1)C=CC(=C2)C)(O)O
InChIKey DHNHZPQPQAINDI-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

(5-Methyl-1-benzothiophen-2-yl)boronic acid is a solid with a crystalline form. It has a molecular w...

Compound Q&A

What industries use (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

(5-Methyl-1-benzothiophen-2-yl)boronic acid is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

When handling (5-Methyl-1-benzothiophen-2-yl)boronic acid, it is important to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...