Compound Q&A

What are the physical and chemical properties of (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

Answer

(5-Methyl-1-benzothiophen-2-yl)boronic acid
(5-Methyl-1-benzothiophen-2-yl)boronic acid is a solid with a crystalline form. It has a molecular weight of approximately 283.3 g/mol and is slightly soluble in water. It is reactive and readily forms coordination complexes with various metals. This compound is often used in organic synthesis due to its reactivity and specific functional groups.

About

English Name (5-Methyl-1-benzothiophen-2-yl)boronic acid
Molecular Formula C9H9BO2S
Molecular Weight 192.05 g/mol
SMILES B(C1=CC2=C(S1)C=CC(=C2)C)(O)O
InChIKey DHNHZPQPQAINDI-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5) typically synthesized?

(5-Methyl-1-benzothiophen-2-yl)boronic acid is typically synthesized via a Suzuki coupling reaction,...

Compound Q&A

What industries use (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

(5-Methyl-1-benzothiophen-2-yl)boronic acid is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling (5-Methyl-1-benzothiophen-2-yl)boronic acid (CAS: 136099-65-5)?

When handling (5-Methyl-1-benzothiophen-2-yl)boronic acid, it is important to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...