Compound Q&A

What precautions should be taken when handling 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

Answer

3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
When handling this compound, use appropriate personal protective equipment (PPE) such as gloves and lab coat. Work in a well-ventilated area or a fume hood. Ensure proper storage in a sealed container away from moisture and heat. In case of spill, handle carefully using appropriate cleanup procedures and consult the Safety Data Sheet (SDS) for detailed instructions.

About

English Name 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
Molecular Formula C36H26F12O2
Molecular Weight 718.58 g/mol
SMILES FC(F)(F)c1cc(cc(c1)C(F)(F)F)c2cc6c(c(c2O)c3c(O)c(cc4c3CCCC4)c5cc(cc(c5)C(F)(F)F)C(F)(F)F)CCCC6
InChIKey IZGSABWUJQZVAQ-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

The compound has a crystalline form with a high melting point. Its molecular weight is approximately...

Compound Q&A

How is 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4) typically synthesized?

This compound is typically synthesized through a multi-step process involving the coupling of naphth...

Compound Q&A

What industries use 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

This compound is used in the pharmaceutical industry for its unique electronic properties and potent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...