Compound Q&A

How is 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4) typically synthesized?

Answer

3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
This compound is typically synthesized through a multi-step process involving the coupling of naphthalene derivatives with triflic anhydride under appropriate conditions. The reaction is catalyzed by a palladium complex and proceeds with good yields. The overall process requires careful control of temperature and solvent to achieve high selectivity and purity.

About

English Name 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
Molecular Formula C36H26F12O2
Molecular Weight 718.58 g/mol
SMILES FC(F)(F)c1cc(cc(c1)C(F)(F)F)c2cc6c(c(c2O)c3c(O)c(cc4c3CCCC4)c5cc(cc(c5)C(F)(F)F)C(F)(F)F)CCCC6
InChIKey IZGSABWUJQZVAQ-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

The compound has a crystalline form with a high melting point. Its molecular weight is approximately...

Compound Q&A

What industries use 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

This compound is used in the pharmaceutical industry for its unique electronic properties and potent...

Compound Q&A

What precautions should be taken when handling 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...