Compound Q&A

What are the physical and chemical properties of 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

Answer

3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
The compound has a crystalline form with a high melting point. Its molecular weight is approximately 698.24 g/mol. It has low solubility in water but is soluble in organic solvents such as dichloromethane and acetonitrile. Chemically, it is reactive towards nucleophiles and electrophiles, showing good stability under neutral and basic conditions.

About

English Name 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol
Molecular Formula C36H26F12O2
Molecular Weight 718.58 g/mol
SMILES FC(F)(F)c1cc(cc(c1)C(F)(F)F)c2cc6c(c(c2O)c3c(O)c(cc4c3CCCC4)c5cc(cc(c5)C(F)(F)F)C(F)(F)F)CCCC6
InChIKey IZGSABWUJQZVAQ-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4) typically synthesized?

This compound is typically synthesized through a multi-step process involving the coupling of naphth...

Compound Q&A

What industries use 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

This compound is used in the pharmaceutical industry for its unique electronic properties and potent...

Compound Q&A

What precautions should be taken when handling 3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-5,5',6,6',7,7',8,8'-octahydro-1,1'-binaphthalene-2,2'-diol (CAS: 618854-91-4)?

When handling this compound, use appropriate personal protective equipment (PPE) such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...