Compound Q&A

What industries use (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

Answer

(2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is used in the pharmaceutical industry as an intermediate for the synthesis of various drug candidates. It is also utilized in the sensor industry for its ability to interact with metal ions and in semiconductors for its electronic properties. Its unique chemical structure makes it valuable in polymer synthesis for developing functional materials and in biochemistry for studying protein interactions.

About

CAS No 16832-24-9
English Name (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
Molecular Formula C13H15N3O2
Molecular Weight 245.28 g/mol
SMILES C1=CC=C(C=C1)CN2C=C(N=C2)CC(C(=O)O)N
InChIKey NMXSWQMJOZUQKY-LBPRGKRZSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is a crystalline soli...

Compound Q&A

How is (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) typically synthesized?

The synthesis of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is typic...

Compound Q&A

What precautions should be taken when handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

When handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...