Compound Q&A

What are the physical and chemical properties of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

Answer

(2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is a crystalline solid with a molecular weight of approximately 292.33 g/mol. It has a pKₐ value of around 9.5 and is moderately soluble in water. This compound reacts readily with bases due to its amino group and displays moderate reactivity in the presence of acids. It is stable under normal storage conditions but should be protected from moisture and air exposure.

About

CAS No 16832-24-9
English Name (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
Molecular Formula C13H15N3O2
Molecular Weight 245.28 g/mol
SMILES C1=CC=C(C=C1)CN2C=C(N=C2)CC(C(=O)O)N
InChIKey NMXSWQMJOZUQKY-LBPRGKRZSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) typically synthesized?

The synthesis of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is typic...

Compound Q&A

What industries use (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is used in the pharma...

Compound Q&A

What precautions should be taken when handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

When handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...