Compound Q&A

How is (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) typically synthesized?

Answer

(2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
The synthesis of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is typically achieved via a multistep process. Starting from 1-benzyl-1H-imidazole and glycine, the reaction proceeds through condensation followed by amidation. This process involves the use of coupling agents like HATU or EDC and a suitable base like DIPEA. The yield is usually around 70-80%, and the product can be purified by column chromatography or recrystallization.

About

CAS No 16832-24-9
English Name (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid
Molecular Formula C13H15N3O2
Molecular Weight 245.28 g/mol
SMILES C1=CC=C(C=C1)CN2C=C(N=C2)CC(C(=O)O)N
InChIKey NMXSWQMJOZUQKY-LBPRGKRZSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is a crystalline soli...

Compound Q&A

What industries use (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

The (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9) is used in the pharma...

Compound Q&A

What precautions should be taken when handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9)?

When handling (2S)-2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoic acid (CAS: 16832-24-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...