Compound Q&A

How is Proadrenomedullin (1-20) (human) (CAS: 150238-87-2) typically synthesized?

Answer

Proadrenomedullin (1-20) (human)
Proadrenomedullin (1-20) (human) is synthesized through solid-phase peptide synthesis using Fmoc chemistry. The synthesis involves stepwise coupling of amino acids and protection/deprotection of the growing peptide chain. Yield and selectivity are typically high, and the final product is purified using HPLC to ensure high purity.

About

English Name Proadrenomedullin (1-20) (human)
Molecular Formula C112H178N36O27
Molecular Weight 2460.8 g/mol
SMILES CC(C)CC(C(=O)NC(CO)C(=O)NC(CCCNC(=N)N)C(=O)N)NC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(CCC(=O)O)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(C(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(C)N
InChIKey PIRWNASAJNPKHT-SHZATDIYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

Proadrenomedullin (1-20) (human) is a polypeptide with a molecular weight of approximately 2479.42 D...

Compound Q&A

What industries use Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

Proadrenomedullin (1-20) (human) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

When handling Proadrenomedullin (1-20) (human), it is recommended to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...