Compound Q&A

What are the physical and chemical properties of Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

Answer

Proadrenomedullin (1-20) (human)
Proadrenomedullin (1-20) (human) is a polypeptide with a molecular weight of approximately 2479.42 Da. It has a crystalline form that is stable under neutral conditions and is poorly soluble in water. The compound is reactive towards proteases, which can lead to degradation. It is typically stored dry at -20°C and dissolved in appropriate buffers for use in biochemical assays.

About

English Name Proadrenomedullin (1-20) (human)
Molecular Formula C112H178N36O27
Molecular Weight 2460.8 g/mol
SMILES CC(C)CC(C(=O)NC(CO)C(=O)NC(CCCNC(=N)N)C(=O)N)NC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C21)NC(=O)C(CCCCN)NC(=O)C(CC(=O)N)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(CCC(=O)O)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(C(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(C)N
InChIKey PIRWNASAJNPKHT-SHZATDIYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is Proadrenomedullin (1-20) (human) (CAS: 150238-87-2) typically synthesized?

Proadrenomedullin (1-20) (human) is synthesized through solid-phase peptide synthesis using Fmoc che...

Compound Q&A

What industries use Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

Proadrenomedullin (1-20) (human) is primarily used in the pharmaceutical industry for its potential ...

Compound Q&A

What precautions should be taken when handling Proadrenomedullin (1-20) (human) (CAS: 150238-87-2)?

When handling Proadrenomedullin (1-20) (human), it is recommended to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...