Compound Q&A

What precautions should be taken when handling (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

Answer

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid
When handling (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid, use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood. Spills should be handled with appropriate absorbent materials, and the area should be cleaned thoroughly. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal procedures.

About

CAS No 19017-52-8
English Name (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid
Molecular Formula C11H10ClNO2
Molecular Weight 223.65899999999996 g/mol
SMILES CC1=C(C2=C(N1)C=CC(=C2)Cl)CC(=O)O
InChIKey OAIODEZFMSXHFQ-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid is a colorless to white crystalline solid with a molecu...

Compound Q&A

How is (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8) typically synthesized?

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid is synthesized through the acetylation of 5-chloro-2-me...

Compound Q&A

What industries use (5-Chloro-2-methyl-1H-indol-3-yl)acetic acid (CAS: 19017-52-8)?

(5-Chloro-2-methyl-1H-indol-3-yl)acetic acid finds use in the pharmaceutical industry for the synthe...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...